ChemNet > CAS > 374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
374790-97-3 4-Bromo-3-fluorobenzeneboronic acid
Nama produk |
4-Bromo-3-fluorobenzeneboronic acid |
Nama Inggeris |
4-Bromo-3-fluorobenzeneboronic acid; 4-Bromo-3-fluorophenylboronic acid |
MF |
C6H5BBrFO2 |
Berat Molekul |
218.8161 |
InChI |
InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
CAS NO |
374790-97-3 |
Struktur Molekul |
|
Kepadatan |
1.75g/cm3 |
Titik didih |
314.7°C at 760 mmHg |
Indeks bias |
1.571 |
Titik nyala |
144.1°C |
Tekanan wap |
0.000195mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|