ChemNet > CAS > 374898-00-7 1-Benzyl-4-methylpiperazine hydrochloride
374898-00-7 1-Benzyl-4-methylpiperazine hydrochloride
| Nama produk |
1-Benzyl-4-methylpiperazine hydrochloride |
| Nama Inggeris |
1-Benzyl-4-methylpiperazine hydrochloride; 1-methyl-4-benzylpiperazine hcl; 1-benzyl-4-methylpiperazine; 1-benzyl-4-methyl-piperazin-4-ium chloride |
| MF |
C12H19ClN2 |
| Berat Molekul |
226.7457 |
| InChI |
InChI=1/C12H18N2.ClH/c1-13-7-9-14(10-8-13)11-12-5-3-2-4-6-12;/h2-6H,7-11H2,1H3;1H |
| CAS NO |
374898-00-7 |
| Struktur Molekul |
|
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
