ChemNet > CAS > 3773-14-6 2,4,5-Trichlorothiophenol
3773-14-6 2,4,5-Trichlorothiophenol
| Nama produk |
2,4,5-Trichlorothiophenol |
| Nama Inggeris |
2,4,5-Trichlorothiophenol; 2,4,5-Trichlorobenzenethiol; Trichlorothiophenol; 2,4,5-trichlorobenzenethiolate |
| MF |
C6H2Cl3S |
| Berat Molekul |
212.5046 |
| InChI |
InChI=1/C6H3Cl3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/p-1 |
| CAS NO |
3773-14-6 |
| EINECS |
223-223-7 |
| Struktur Molekul |
|
| Titik lebur |
117-118℃ |
| Titik didih |
283.2°C at 760 mmHg |
| Titik nyala |
114.6°C |
| Tekanan wap |
0.0055mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
