ChemNet > CAS > 39828-35-8 2,4- dimethoxybenzoyl chloride
39828-35-8 2,4- dimethoxybenzoyl chloride
| Nama produk |
2,4- dimethoxybenzoyl chloride |
| Nama Inggeris |
2,4- dimethoxybenzoyl chloride; 2,4-DIMETHOXYBENZOYL CHLORIDE; benzoyl chloride, 2,4-dimethoxy- |
| MF |
C9H9ClO3 |
| Berat Molekul |
200.619 |
| InChI |
InChI=1/C9H9ClO3/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
| CAS NO |
39828-35-8 |
| Struktur Molekul |
|
| Kepadatan |
1.224g/cm3 |
| Titik lebur |
58℃ |
| Titik didih |
306.7°C at 760 mmHg |
| Indeks bias |
1.52 |
| Titik nyala |
134.1°C |
| Tekanan wap |
0.000757mmHg at 25°C |
| Cinta bahaya |
 C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
