ChemNet > CAS > 4022-81-5 1-(4-Chlorophenyl)-biguanide hydrochloride
4022-81-5 1-(4-Chlorophenyl)-biguanide hydrochloride
| Nama produk |
1-(4-Chlorophenyl)-biguanide hydrochloride |
| Nama Inggeris |
1-(4-Chlorophenyl)-biguanide hydrochloride; 1-(4-Chlorophenyl)biguanide hydrochloride; N-(4-chlorophenyl)imidodicarbonimidic diamide; 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine hydrochloride (1:1); N-{(1E)-amino[(diaminomethylidene)ammonio]methylidene}-4-chloroanilinium |
| MF |
C8H12ClN5 |
| Berat Molekul |
213.6663 |
| InChI |
InChI=1/C8H10ClN5/c9-5-1-3-6(4-2-5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2 |
| CAS NO |
4022-81-5 |
| EINECS |
226-155-6 |
| Struktur Molekul |
|
| Titik didih |
426.4°C at 760 mmHg |
| Titik nyala |
211.7°C |
| Tekanan wap |
1.78E-07mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
