ChemNet > CAS > 40400-15-5 2-Iodophenylacetonitrile
40400-15-5 2-Iodophenylacetonitrile
| Nama produk |
2-Iodophenylacetonitrile |
| Nama Inggeris |
2-Iodophenylacetonitrile; 2-Iodobenzyl cyanide |
| MF |
C8H6IN |
| Berat Molekul |
243.0444 |
| InChI |
InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2 |
| CAS NO |
40400-15-5 |
| Struktur Molekul |
|
| Kepadatan |
1.764g/cm3 |
| Titik didih |
306°C at 760 mmHg |
| Indeks bias |
1.624 |
| Titik nyala |
138.8°C |
| Tekanan wap |
0.000795mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
