4079-52-1 2-Methoxyacetophenone
Nama produk |
2-Methoxyacetophenone |
Nama Inggeris |
2-Methoxyacetophenone; 2-Acetylanisole; alpha-Methoxyacetophenone; 2-methoxy-1-phenylethanone; 1-(2-methoxyphenyl)ethanone |
MF |
C9H10O2 |
Berat Molekul |
150.1745 |
InChI |
InChI=1/C9H10O2/c1-7(10)8-5-3-4-6-9(8)11-2/h3-6H,1-2H3 |
CAS NO |
4079-52-1 |
EINECS |
223-802-4 |
Struktur Molekul |
|
Kepadatan |
1.035g/cm3 |
Titik lebur |
7-8℃ |
Titik didih |
245°C at 760 mmHg |
Indeks bias |
1.504 |
Titik nyala |
92.8°C |
Tekanan wap |
0.0294mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|