ChemNet > CAS > 4144-62-1 5-Benzoylpentanoic acid
4144-62-1 5-Benzoylpentanoic acid
| Nama produk |
5-Benzoylpentanoic acid |
| Nama Inggeris |
5-Benzoylpentanoic acid; 6-Oxo-6-phenylhexanoic acid |
| MF |
C12H14O3 |
| Berat Molekul |
206.2378 |
| InChI |
InChI=1/C12H14O3/c13-11(8-4-5-9-12(14)15)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H,14,15) |
| CAS NO |
4144-62-1 |
| Struktur Molekul |
|
| Kepadatan |
1.135g/cm3 |
| Titik didih |
385.3°C at 760 mmHg |
| Indeks bias |
1.533 |
| Titik nyala |
201°C |
| Tekanan wap |
1.26E-06mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
