ChemNet > CAS > 4160-51-4 4'-methoxybutyrophenone
4160-51-4 4'-methoxybutyrophenone
| Nama produk |
4'-methoxybutyrophenone |
| Nama Inggeris |
4'-methoxybutyrophenone; 1-(4-Methoxyphenyl)butan-1-on; 1-(4-Methoxyphenyl)butan-1-one; 1-Butanone, 1- (4-methoxyphenyl)-; 1-butanone, 1-(4-methoxyphenyl)-; 4'-Methoxy-butyrophenone; 4-Methoxybutyrophenone; Butyrophenone, 4'-methoxy-; p-Methoxybutyrophenone; 4-Butyrylanisole |
| MF |
C11H14O2 |
| Berat Molekul |
178.2277 |
| InChI |
InChI=1/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| CAS NO |
4160-51-4 |
| EINECS |
223-995-5 |
| Struktur Molekul |
|
| Kepadatan |
1.001g/cm3 |
| Titik didih |
288.3°C at 760 mmHg |
| Indeks bias |
1.498 |
| Titik nyala |
124.3°C |
| Tekanan wap |
0.00236mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
