ChemNet > CAS > 4160-63-8 2-(4-Methoxybenzoyl)thiophene
4160-63-8 2-(4-Methoxybenzoyl)thiophene
| Nama produk |
2-(4-Methoxybenzoyl)thiophene |
| Nama Inggeris |
2-(4-Methoxybenzoyl)thiophene; p-anisyl thiophen-2-yl ketone; (4-methoxyphenyl)(thiophen-2-yl)methanone; (4-methylphenyl)(thiophen-2-yl)methanone |
| MF |
C12H10OS |
| Berat Molekul |
202.2722 |
| InChI |
InChI=1/C12H10OS/c1-9-4-6-10(7-5-9)12(13)11-3-2-8-14-11/h2-8H,1H3 |
| CAS NO |
4160-63-8 |
| EINECS |
223-997-6 |
| Struktur Molekul |
|
| Kepadatan |
1.167g/cm3 |
| Titik lebur |
73-76℃ |
| Titik didih |
340.6°C at 760 mmHg |
| Indeks bias |
1.599 |
| Titik nyala |
159.8°C |
| Tekanan wap |
8.52E-05mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
