ChemNet > CAS > 42712-64-1 2-Amino-4-hydroxyquinoline hydrate
42712-64-1 2-Amino-4-hydroxyquinoline hydrate
| Nama produk |
2-Amino-4-hydroxyquinoline hydrate |
| Nama Inggeris |
2-Amino-4-hydroxyquinoline hydrate; 2-Aminoquinolinol hydrate; 2-aminoquinolin-4(1H)-one; 2-Amino-4-1H-quinolinone |
| MF |
C9H8N2O |
| Berat Molekul |
160.1726 |
| InChI |
InChI=1/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
| CAS NO |
42712-64-1 |
| Struktur Molekul |
|
| Kepadatan |
1.254g/cm3 |
| Titik didih |
294.1°C at 760 mmHg |
| Indeks bias |
1.623 |
| Titik nyala |
131.7°C |
| Tekanan wap |
0.00166mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
