4295-06-1 4-Chloroquinaldine
Nama produk |
4-Chloroquinaldine |
Nama Inggeris |
4-Chloroquinaldine; 4-Chloro-2-methylquinoline; 2-Methyl-4-chloroquinoline |
MF |
C10H8ClN |
Berat Molekul |
177.6302 |
InChI |
InChI=1/C10H8ClN/c1-7-6-9(11)8-4-2-3-5-10(8)12-7/h2-6H,1H3 |
CAS NO |
4295-06-1 |
EINECS |
224-300-8 |
Struktur Molekul |
|
Kepadatan |
1.225g/cm3 |
Titik lebur |
39-270℃ |
Titik didih |
269.5°C at 760 mmHg |
Indeks bias |
1.634 |
Titik nyala |
140.2°C |
Tekanan wap |
0.012mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|