ChemNet > CAS > 43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
43088-42-2 Ethyl 2-amino-4-methylthiophene-3-carboxylate
Nama produk |
Ethyl 2-amino-4-methylthiophene-3-carboxylate |
Nama Inggeris |
Ethyl 2-amino-4-methylthiophene-3-carboxylate; 2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester |
MF |
C8H11NO2S |
Berat Molekul |
185.2434 |
InChI |
InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
CAS NO |
43088-42-2 |
Struktur Molekul |
|
Kepadatan |
1.219g/cm3 |
Titik lebur |
72℃ |
Titik didih |
279.1°C at 760 mmHg |
Indeks bias |
1.573 |
Titik nyala |
122.6°C |
Tekanan wap |
0.00411mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|