4404-45-9 n-Hexyl isothiocyanate
Nama produk |
n-Hexyl isothiocyanate |
Nama Inggeris |
n-Hexyl isothiocyanate; 1-Hexyl isothiocyanate; 1-Isothiocyanatohexane; 2-isothiocyanatohexane |
MF |
C7H13NS |
Berat Molekul |
143.2498 |
InChI |
InChI=1/C7H13NS/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3 |
CAS NO |
4404-45-9 |
EINECS |
224-549-2 |
Struktur Molekul |
|
Kepadatan |
0.91g/cm3 |
Titik didih |
205.9°C at 760 mmHg |
Indeks bias |
1.484 |
Titik nyala |
74°C |
Tekanan wap |
0.349mmHg at 25°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|