ChemNet > CAS > 446-09-3 2-Bromo-5-fluoronitrobenzene
446-09-3 2-Bromo-5-fluoronitrobenzene
| Nama produk |
2-Bromo-5-fluoronitrobenzene |
| Nama Inggeris |
2-Bromo-5-fluoronitrobenzene; 1-Bromo-4-fluoro-2-nitrobenzene |
| MF |
C6H3BrFNO2 |
| Berat Molekul |
219.9959 |
| InChI |
InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| CAS NO |
446-09-3 |
| EINECS |
207-160-2 |
| Struktur Molekul |
|
| Kepadatan |
1.808g/cm3 |
| Titik lebur |
37-39℃ |
| Titik didih |
220.9°C at 760 mmHg |
| Indeks bias |
1.579 |
| Titik nyala |
87.4°C |
| Tekanan wap |
0.164mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
