ChemNet > CAS > 4651-82-5 2-aminothiophene-3-carbonitrile
4651-82-5 2-aminothiophene-3-carbonitrile
| Nama produk |
2-aminothiophene-3-carbonitrile |
| Nama Inggeris |
2-aminothiophene-3-carbonitrile; 2-Amino-3-cyanothiophene; 2-Amino-3-thiophenecarbonitrile |
| MF |
C5H4N2S |
| Berat Molekul |
124.1637 |
| InChI |
InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| CAS NO |
4651-82-5 |
| Struktur Molekul |
|
| Kepadatan |
1.33g/cm3 |
| Titik lebur |
104℃ |
| Titik didih |
317.5°C at 760 mmHg |
| Indeks bias |
1.627 |
| Titik nyala |
145.8°C |
| Tekanan wap |
0.000384mmHg at 25°C |
| Cinta bahaya |
 Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|
