ChemNet > CAS > 465514-33-4 (2-morpholinophenyl)metanol
465514-33-4 (2-morpholinophenyl)metanol
| Nama produk |
(2-morpholinophenyl)metanol |
| Sinonim |
(2-morpholin-4-ylphenyl)metanol |
| Nama Inggeris |
(2-morpholinophenyl)methanol;(2-morpholin-4-ylphenyl)methanol |
| MF |
C11H15NO2 |
| Berat Molekul |
193.2423 |
| InChI |
InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
| CAS NO |
465514-33-4 |
| Struktur Molekul |
|
| Kepadatan |
1.16g/cm3 |
| Titik lebur |
54℃ |
| Titik didih |
362.8°C at 760 mmHg |
| Indeks bias |
1.568 |
| Titik nyala |
173.2°C |
| Tekanan wap |
6.7E-06mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|