ChemNet > CAS > 4731-53-7 Tri-n-octylphosphine
4731-53-7 Tri-n-octylphosphine
| Nama produk |
Tri-n-octylphosphine |
| Nama Inggeris |
Tri-n-octylphosphine;Phosphine, trioctyl-; Trioctylphosphine; trioctylphosphane; Trioctyl phosphine |
| MF |
C24H51P |
| Berat Molekul |
370.6355 |
| InChI |
InChI=1/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| CAS NO |
4731-53-7 |
| EINECS |
225-234-2 |
| Struktur Molekul |
|
| Titik didih |
445°C at 760 mmHg |
| Titik nyala |
236°C |
| Tekanan wap |
1.07E-07mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
