ChemNet > CAS > 4741-53-1 Tetraphenylphthalic anhydride
4741-53-1 Tetraphenylphthalic anhydride
Nama produk |
Tetraphenylphthalic anhydride |
Nama Inggeris |
Tetraphenylphthalic anhydride;4,5,6,7-tetraphenyl-2-benzofuran-1,3-dione |
MF |
C32H20O3 |
Berat Molekul |
452.4994 |
InChI |
InChI=1/C32H20O3/c33-31-29-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)26(22-15-7-2-8-16-22)28(30(29)32(34)35-31)24-19-11-4-12-20-24/h1-20H |
CAS NO |
4741-53-1 |
EINECS |
225-253-6 |
Struktur Molekul |
|
Kepadatan |
1.244g/cm3 |
Titik didih |
596°C at 760 mmHg |
Indeks bias |
1.658 |
Titik nyala |
290.4°C |
Tekanan wap |
3.6E-14mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|