ChemNet > CAS > 4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
4792-58-9 5-methoxyindole-2-carboxylic acid ethyl ester
| Nama produk |
5-methoxyindole-2-carboxylic acid ethyl ester |
| Nama Inggeris |
5-methoxyindole-2-carboxylic acid ethyl ester; 1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 1H-Indole-2-carboxylic acid, 5-methoxy-, ethyl ester; 5-22-05-00181 (Beilstein Handbook Reference); Ethyl 5-methoxy-1H-indole-2-carboxylate; Methoxy-5 indole carboxylate d'ethyle-2; Ethyl 5-methoxyindole-2-carboxylate |
| MF |
C12H13NO3 |
| Berat Molekul |
219.2365 |
| InChI |
InChI=1/C12H13NO3/c1-3-16-12(14)11-7-8-6-9(15-2)4-5-10(8)13-11/h4-7,13H,3H2,1-2H3 |
| CAS NO |
4792-58-9 |
| Struktur Molekul |
|
| Kepadatan |
1.216g/cm3 |
| Titik didih |
380.2°C at 760 mmHg |
| Indeks bias |
1.599 |
| Titik nyala |
183.7°C |
| Tekanan wap |
5.54E-06mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
