ChemNet > CAS > 4837-20-1 4-(difluoromethoxy)benzoic acid
4837-20-1 4-(difluoromethoxy)benzoic acid
Nama produk |
4-(difluoromethoxy)benzoic acid |
Nama Inggeris |
4-(difluoromethoxy)benzoic acid;4-(difluoromethoxy)benzoate |
MF |
C8H5F2O3 |
Berat Molekul |
187.1209 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H,11,12)/p-1 |
CAS NO |
4837-20-1 |
Struktur Molekul |
|
Titik lebur |
169-171℃ |
Titik didih |
272.1°C at 760 mmHg |
Titik nyala |
118.3°C |
Tekanan wap |
0.00304mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|