53293-00-8 5-Hexynoic acid
Nama produk |
5-Hexynoic acid |
Nama Inggeris |
5-Hexynoic acid; Hex-5-ynoic acid; hex-5-ynoate |
MF |
C6H7O2 |
Berat Molekul |
111.1191 |
InChI |
InChI=1/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8)/p-1 |
CAS NO |
53293-00-8 |
Struktur Molekul |
|
Titik didih |
220.6°C at 760 mmHg |
Titik nyala |
99.6°C |
Tekanan wap |
0.042mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|