536-59-4 L(-)-Perillyl alcohol
Nama produk |
L(-)-Perillyl alcohol |
Nama Inggeris |
L(-)-Perillyl alcohol; 4-isopropenylcyclohex-1-en-1-ylmethanol; [4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; [(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; Dihydro cuminyl alcohol |
MF |
C10H16O |
Berat Molekul |
152.2334 |
InChI |
InChI=1/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1 |
CAS NO |
536-59-4 |
EINECS |
208-639-9 |
Struktur Molekul |
|
Kepadatan |
0.94g/cm3 |
Titik didih |
241.2°C at 760 mmHg |
Indeks bias |
1.491 |
Titik nyala |
99.6°C |
Tekanan wap |
0.00628mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|