ChemNet > CAS > 536-59-4 L(-)-Perillyl alcohol
536-59-4 L(-)-Perillyl alcohol
| Nama produk |
L(-)-Perillyl alcohol |
| Nama Inggeris |
L(-)-Perillyl alcohol; 4-isopropenylcyclohex-1-en-1-ylmethanol; [4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; [(4S)-4-(prop-1-en-2-yl)cyclohex-1-en-1-yl]methanol; Dihydro cuminyl alcohol |
| MF |
C10H16O |
| Berat Molekul |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1 |
| CAS NO |
536-59-4 |
| EINECS |
208-639-9 |
| Struktur Molekul |
|
| Kepadatan |
0.94g/cm3 |
| Titik didih |
241.2°C at 760 mmHg |
| Indeks bias |
1.491 |
| Titik nyala |
99.6°C |
| Tekanan wap |
0.00628mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
