ChemNet > CAS > 5407-98-7 cyclobutyl phenyl ketone
5407-98-7 cyclobutyl phenyl ketone
| Nama produk |
cyclobutyl phenyl ketone |
| Nama Inggeris |
cyclobutyl phenyl ketone; Benzoylcyclobutane; cyclobutyl(phenyl)methanone |
| MF |
C11H12O |
| Berat Molekul |
160.2124 |
| InChI |
InChI=1/C11H12O/c12-11(10-7-4-8-10)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2 |
| CAS NO |
5407-98-7 |
| EINECS |
226-473-5 |
| Struktur Molekul |
|
| Kepadatan |
1.082g/cm3 |
| Titik didih |
260°C at 760 mmHg |
| Indeks bias |
1.563 |
| Titik nyala |
102.5°C |
| Tekanan wap |
0.0125mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
