ChemNet > CAS > 54714-10-2 2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide
54714-10-2 2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide
| Nama produk |
2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide |
| Nama Inggeris |
2,5-Diphenyl-4-hydroxy-3-oxo-2,3-dihydrothiophene 1,1-dioxide; 2,5-diphenyl-4-hydroxy-3-thiophenone 1,1-dioxide; 4-hydroxy-2,5-diphenyl-3(2H)-thiophenone-1,1-diox; HOTDO~4-Hydroxy-2,5-diphenyl-3(2H)thiophenone-1,1-dioxide; 4-Hydroxy-2,5-diphenyl-3-thiophenone 1,1-dioxide; 4-hydroxy-2,5-diphenylthiophen-3(2H)-one 1,1-dioxide; 4-hydroxy-2,5-diphenylthiophen-3(2H)-one |
| MF |
C16H12O2S |
| Berat Molekul |
268.3303 |
| InChI |
InChI=1/C16H12O2S/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10,15,18H |
| CAS NO |
54714-10-2 |
| Struktur Molekul |
|
| Kepadatan |
1.346g/cm3 |
| Titik lebur |
238-241℃ |
| Titik didih |
441.06°C at 760 mmHg |
| Indeks bias |
1.697 |
| Titik nyala |
220.546°C |
| Tekanan wap |
0mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
