54745-92-5 2-quinoxaloyl klorida
Nama produk |
2-quinoxaloyl klorida |
Sinonim |
; 2-Quinoxalinecarbonyl klorida; quinoxaline-2-karbonil klorida |
Nama Inggeris |
2-quinoxaloyl chloride; 2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
MF |
C9H5ClN2O |
Berat Molekul |
192.6018 |
InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
CAS NO |
54745-92-5 |
EINECS |
259-315-9 |
Struktur Molekul |
|
Kepadatan |
1.411g/cm3 |
Titik lebur |
113℃ |
Titik didih |
324.4°C at 760 mmHg |
Indeks bias |
1.662 |
Titik nyala |
150°C |
Tekanan wap |
0.000246mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|