ChemNet > CAS > 56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
56136-84-6 4,5-Methylenedioxy-2-nitroacetophenone
| Nama produk |
4,5-Methylenedioxy-2-nitroacetophenone |
| Nama Inggeris |
4,5-Methylenedioxy-2-nitroacetophenone; 1-(6-Nitro-1,3-benzodioxol-5-yl)ethanone; 4',5'-Methylenedioxy-2'-nitroacetophenone |
| MF |
C9H7NO5 |
| Berat Molekul |
209.1556 |
| InChI |
InChI=1/C9H7NO5/c1-5(11)6-2-8-9(15-4-14-8)3-7(6)10(12)13/h2-3H,4H2,1H3 |
| CAS NO |
56136-84-6 |
| EINECS |
260-010-8 |
| Struktur Molekul |
|
| Kepadatan |
1.452g/cm3 |
| Titik didih |
392.4°C at 760 mmHg |
| Indeks bias |
1.595 |
| Titik nyala |
202.5°C |
| Tekanan wap |
2.29E-06mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
