ChemNet > CAS > 57264-46-7 2-Chloro-6-methylbenzylamine
57264-46-7 2-Chloro-6-methylbenzylamine
| Nama produk |
2-Chloro-6-methylbenzylamine |
| Nama Inggeris |
2-Chloro-6-methylbenzylamine;1-(2-chloro-6-methylphenyl)methanamine |
| MF |
C8H10ClN |
| Berat Molekul |
155.6247 |
| InChI |
InChI=1/C8H10ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,5,10H2,1H3 |
| CAS NO |
57264-46-7 |
| Struktur Molekul |
|
| Kepadatan |
1.13g/cm3 |
| Titik didih |
242.8°C at 760 mmHg |
| Indeks bias |
1.558 |
| Titik nyala |
115.9°C |
| Tekanan wap |
0.0332mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
