ChemNet > CAS > 5785-66-0 Cyclopropyl diphenyl carbinol
5785-66-0 Cyclopropyl diphenyl carbinol
Nama produk |
Cyclopropyl diphenyl carbinol |
Nama Inggeris |
Cyclopropyl diphenyl carbinol; alpha-Cyclopropylbenzhydrol~Cyclopropyl diphenyl carbinol; Cyclopropyldiphenylmethanol; alpha-cyclopropylbenzhydryl alcohol; N-[(1E)-(4-methoxyphenyl)methylidene]-3,5-dimethyl-4H-1,2,4-triazol-4-amine |
MF |
C12H14N4O |
Berat Molekul |
230.2658 |
InChI |
InChI=1/C12H14N4O/c1-9-14-15-10(2)16(9)13-8-11-4-6-12(17-3)7-5-11/h4-8H,1-3H3/b13-8+ |
CAS NO |
5785-66-0 |
EINECS |
227-312-1 |
Struktur Molekul |
|
Kepadatan |
1.16g/cm3 |
Titik lebur |
82-85℃ |
Titik didih |
419°C at 760 mmHg |
Indeks bias |
1.59 |
Titik nyala |
207.2°C |
Tekanan wap |
3.13E-07mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|