ChemNet > CAS > 57910-98-2 4-methyl-2-nitrophenyl isocyanate
57910-98-2 4-methyl-2-nitrophenyl isocyanate
| Nama produk |
4-methyl-2-nitrophenyl isocyanate |
| Nama Inggeris |
4-methyl-2-nitrophenyl isocyanate;1-isocyanato-4-methyl-2-nitrobenzene |
| MF |
C8H6N2O3 |
| Berat Molekul |
178.1448 |
| InChI |
InChI=1/C8H6N2O3/c1-6-2-3-7(9-5-11)8(4-6)10(12)13/h2-4H,1H3 |
| CAS NO |
57910-98-2 |
| Struktur Molekul |
|
| Kepadatan |
1.27g/cm3 |
| Titik lebur |
57-61℃ |
| Titik didih |
303°C at 760 mmHg |
| Indeks bias |
1.578 |
| Titik nyala |
137°C |
| Tekanan wap |
0.000957mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
