ChemNet > CAS > 582-22-9 Beta-Methylphenethylamine
582-22-9 Beta-Methylphenethylamine
| Nama produk |
Beta-Methylphenethylamine |
| Nama Inggeris |
Beta-Methylphenethylamine; 1-Amino-2-phenylpropane; 2-Phenylpropylamine; 2-phenylpropan-1-amine; (2R)-2-phenylpropan-1-aminium; (2S)-2-phenylpropan-1-aminium; β-Methylphenethylamine |
| MF |
C9H14N |
| Berat Molekul |
136.2136 |
| InChI |
InChI=1/C9H13N/c1-8(7-10)9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/p+1/t8-/m1/s1 |
| CAS NO |
582-22-9 |
| EINECS |
209-479-2 |
| Struktur Molekul |
|
| Titik didih |
210°C at 760 mmHg |
| Titik nyala |
84.6°C |
| Tekanan wap |
0.197mmHg at 25°C |
| Cinta bahaya |
 C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
