ChemNet > CAS > 589-06-0 4-(4-Fluorophenyl)butyric acid
589-06-0 4-(4-Fluorophenyl)butyric acid
Nama produk |
4-(4-Fluorophenyl)butyric acid |
Nama Inggeris |
4-(4-Fluorophenyl)butyric acid;4-(p-Fluorophenyl)butyric acid; 4-(4-fluorophenyl)butanoate |
MF |
C10H10FO2 |
Berat Molekul |
181.1842 |
InChI |
InChI=1/C10H11FO2/c11-9-6-4-8(5-7-9)2-1-3-10(12)13/h4-7H,1-3H2,(H,12,13)/p-1 |
CAS NO |
589-06-0 |
EINECS |
209-631-8 |
Struktur Molekul |
|
Titik lebur |
38℃ |
Titik didih |
296.5°C at 760 mmHg |
Titik nyala |
133.1°C |
Tekanan wap |
0.000646mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|