589-17-3 4-Bromobenzyl chloride
Nama produk |
4-Bromobenzyl chloride |
Nama Inggeris |
4-Bromobenzyl chloride; 4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
MF |
C7H6BrCl |
Berat Molekul |
205.4795 |
InChI |
InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
CAS NO |
589-17-3 |
EINECS |
209-638-6 |
Struktur Molekul |
|
Kepadatan |
1.541g/cm3 |
Titik lebur |
36-40℃ |
Titik didih |
236°C at 760 mmHg |
Indeks bias |
1.569 |
Titik nyala |
111.7°C |
Tekanan wap |
0.0744mmHg at 25°C |
Cinta bahaya |
C:Corrosive;
|
Kod Risiko |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Penerangan |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|