ChemNet > CAS > 608-05-9 5-methylisatin
608-05-9 5-methylisatin
| Nama produk |
5-methylisatin |
| Nama Inggeris |
5-methylisatin; 5-methylindole-2,3(1H)-dione; 5-methyl-1H-indole-2,3-dione |
| MF |
C9H7NO2 |
| Berat Molekul |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-4H,1H3,(H,10,11,12) |
| CAS NO |
608-05-9 |
| EINECS |
210-152-1 |
| Struktur Molekul |
|
| Kepadatan |
1.301g/cm3 |
| Titik lebur |
180℃ (dec.) |
| Indeks bias |
1.598 |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
