ChemNet > CAS > 610-57-1 2,4-Dinitrobenzyl chloride
610-57-1 2,4-Dinitrobenzyl chloride
Nama produk |
2,4-Dinitrobenzyl chloride |
Nama Inggeris |
2,4-Dinitrobenzyl chloride; alpha-Chloro-2,4-dinitrotoluene; 4-(Chloromethyl)-1,3-dinitrobenzene; 1-(chloromethyl)-2,4-dinitrobenzene |
MF |
C7H5ClN2O4 |
Berat Molekul |
216.5786 |
InChI |
InChI=1/C7H5ClN2O4/c8-4-5-1-2-6(9(11)12)3-7(5)10(13)14/h1-3H,4H2 |
CAS NO |
610-57-1 |
EINECS |
210-230-5 |
Struktur Molekul |
|
Kepadatan |
1.538g/cm3 |
Titik lebur |
34-36℃ |
Titik didih |
349.8°C at 760 mmHg |
Indeks bias |
1.614 |
Titik nyala |
165.4°C |
Tekanan wap |
9.24E-05mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|