ChemNet > CAS > 61277-90-5 (2R)-( )-endo-Norborneol
61277-90-5 (2R)-( )-endo-Norborneol
Nama produk |
(2R)-( )-endo-Norborneol |
Sinonim |
;(1S,2R,4R)-Bicyclo[2.2.1]heptan-2-ol; ( )-endo-2-Norborneol; (1S,2R,4R)-( )-endo-Norborneol |
Nama Inggeris |
(2R)-(+)-endo-Norborneol; (1S,2R,4R)-Bicyclo[2.2.1]heptan-2-ol; (+)-endo-2-Norborneol; (1S,2R,4R)-(+)-endo-Norborneol |
MF |
C7H12O |
Berat Molekul |
112.1696 |
InChI |
InChI=1/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7-/m1/s1 |
CAS NO |
61277-90-5 |
Struktur Molekul |
|
Kepadatan |
1.098g/cm3 |
Titik lebur |
149-154℃ |
Titik didih |
176.499°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
74.376°C |
Tekanan wap |
0.332mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|