623-51-8 Ethyl 2-mercaptoacetate
Nama produk |
Ethyl 2-mercaptoacetate |
Nama Inggeris |
Ethyl 2-mercaptoacetate; Ethyl thioglycolate; Mercaptoacetic acid ethyl ester; Ethyl mercaptoacetate; Ethyl Thioglycollate; 2-Mercapto-acetic acid ethyl ester; ethyl sulfanylacetate |
MF |
C4H8O2S |
Berat Molekul |
120.1701 |
InChI |
InChI=1/C4H8O2S/c1-2-6-4(5)3-7/h7H,2-3H2,1H3 |
CAS NO |
623-51-8 |
EINECS |
210-800-3 |
Struktur Molekul |
|
Kepadatan |
1.072g/cm3 |
Titik didih |
157.8°C at 760 mmHg |
Indeks bias |
1.452 |
Titik nyala |
47.8°C |
Tekanan wap |
2.7mmHg at 25°C |
Cinta bahaya |
T:Toxic;
|
Kod Risiko |
R10:Flammable.;
R25:Toxic if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S16:Keep away from sources of ignition - No smoking.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|