6282-00-4 NN-Dipropylformamide
Nama produk |
NN-Dipropylformamide |
Nama Inggeris |
NN-Dipropylformamide; N,N-Di-n-propylformamide; N,N-dipropylformamide |
MF |
C7H15NO |
Berat Molekul |
129.2001 |
InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
CAS NO |
6282-00-4 |
Struktur Molekul |
|
Kepadatan |
0.869g/cm3 |
Titik didih |
221.3°C at 760 mmHg |
Indeks bias |
1.429 |
Titik nyala |
83.7°C |
Tekanan wap |
0.108mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|