62936-23-6 5-Chlorovanillic acid
Nama produk |
5-Chlorovanillic acid |
Nama Inggeris |
5-Chlorovanillic acid; 5-Chlorovanilic acid; 5-Chloro-4-hydroxy-3-methoxybenzoic acid; 3-chloro-4-hydroxy-5-methoxybenzoic acid |
MF |
C8H7ClO4 |
Berat Molekul |
202.5918 |
InChI |
InChI=1/C8H7ClO4/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3,10H,1H3,(H,11,12) |
CAS NO |
62936-23-6 |
EINECS |
263-766-7 |
Struktur Molekul |
|
Kepadatan |
1.485g/cm3 |
Titik lebur |
241-243℃ |
Titik didih |
352.3°C at 760 mmHg |
Indeks bias |
1.599 |
Titik nyala |
166.9°C |
Tekanan wap |
1.44E-05mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|