ChemNet > CAS > 6326-83-6 Bis(carboxymethyl) trithiocarbonate
6326-83-6 Bis(carboxymethyl) trithiocarbonate
Nama produk |
Bis(carboxymethyl) trithiocarbonate |
Nama Inggeris |
Bis(carboxymethyl) trithiocarbonate; 3,5-dithia-4-thioxo-1,7-heptanedioic acid; 2,2'-(carbonothioyldisulfanediyl)diacetic acid; 2,2'-(carbonothioyldisulfanediyl)diacetate |
MF |
C5H4O4S3 |
Berat Molekul |
224.279 |
InChI |
InChI=1/C5H6O4S3/c6-3(7)1-11-5(10)12-2-4(8)9/h1-2H2,(H,6,7)(H,8,9)/p-2 |
CAS NO |
6326-83-6 |
EINECS |
228-693-7 |
Struktur Molekul |
|
Titik lebur |
170-175℃ |
Titik didih |
532.5°C at 760 mmHg |
Titik nyala |
275.9°C |
Tekanan wap |
9.26E-13mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|