ChemNet > CAS > 63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
63417-81-2 5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole
| Nama produk |
5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole |
| Sinonim |
5-(chloromethyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| Nama Inggeris |
5-(chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole;5-(chloromethyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole |
| MF |
C7H5ClN2OS |
| Berat Molekul |
200.6454 |
| InChI |
InChI=1/C7H5ClN2OS/c8-4-6-9-7(10-11-6)5-2-1-3-12-5/h1-3H,4H2 |
| CAS NO |
63417-81-2 |
| Struktur Molekul |
|
| Kepadatan |
1.421g/cm3 |
| Titik lebur |
59℃ |
| Titik didih |
331.3°C at 760 mmHg |
| Indeks bias |
1.587 |
| Titik nyala |
154.1°C |
| Tekanan wap |
0.000303mmHg at 25°C |
| Cinta bahaya |
 C:Corrosive;
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
