ChemNet > CAS > 63740-97-6 3,4-(Methylenedioxy)butyrophenone
63740-97-6 3,4-(Methylenedioxy)butyrophenone
Nama produk |
3,4-(Methylenedioxy)butyrophenone |
Nama Inggeris |
3,4-(Methylenedioxy)butyrophenone; 1-(1,3-Benzodioxol-5-yl)-1-butanone~5-Butyryl-1,3-benzodioxole; 1-(1,3-benzodioxol-5-yl)butan-1-one |
MF |
C11H12O3 |
Berat Molekul |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-3-9(12)8-4-5-10-11(6-8)14-7-13-10/h4-6H,2-3,7H2,1H3 |
CAS NO |
63740-97-6 |
Struktur Molekul |
|
Kepadatan |
1.163g/cm3 |
Titik didih |
319.3°C at 760 mmHg |
Indeks bias |
1.538 |
Titik nyala |
137.9°C |
Tekanan wap |
0.000342mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|