ChemNet > CAS > 64123-77-9 Methyl 3-fluorophenylacetate
64123-77-9 Methyl 3-fluorophenylacetate
Nama produk |
Methyl 3-fluorophenylacetate |
Nama Inggeris |
Methyl 3-fluorophenylacetate; |
MF |
C9H9FO2 |
Berat Molekul |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-12-9(11)6-7-3-2-4-8(10)5-7/h2-5H,6H2,1H3 |
CAS NO |
64123-77-9 |
Struktur Molekul |
|
Kepadatan |
1.148g/cm3 |
Titik didih |
204°C at 760 mmHg |
Indeks bias |
1.488 |
Titik nyala |
75.3°C |
Tekanan wap |
0.27mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|