ChemNet > CAS > 64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
64399-28-6 1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile
| Nama produk |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile |
| Nama Inggeris |
1-(4-Chlorophenyl)-1-cyclohexanecarbonitrile;1-(4-Chlorophenyl)cyclohexanecarbonitrile |
| MF |
C13H14ClN |
| Berat Molekul |
219.71 |
| InChI |
InChI=1/C13H14ClN/c14-12-6-4-11(5-7-12)13(10-15)8-2-1-3-9-13/h4-7H,1-3,8-9H2 |
| CAS NO |
64399-28-6 |
| EINECS |
264-872-6 |
| Struktur Molekul |
|
| Kepadatan |
1.14g/cm3 |
| Titik lebur |
88-92℃ |
| Titik didih |
350.5°C at 760 mmHg |
| Indeks bias |
1.559 |
| Titik nyala |
143.5°C |
| Tekanan wap |
4.38E-05mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
