ChemNet > CAS > 652-40-4 3,6-difluorophthalic anhydride
652-40-4 3,6-difluorophthalic anhydride
| Nama produk |
3,6-difluorophthalic anhydride |
| Nama Inggeris |
3,6-difluorophthalic anhydride;1,1'-(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)bis(3,4-dimethylbenzene); 4,7-difluoro-2-benzofuran-1,3-dione |
| MF |
C8H2F2O3 |
| Berat Molekul |
184.0965 |
| InChI |
InChI=1/C8H2F2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H |
| CAS NO |
652-40-4 |
| EINECS |
265-687-3 |
| Struktur Molekul |
|
| Kepadatan |
1.658g/cm3 |
| Titik lebur |
218-221℃ |
| Titik didih |
315.7°C at 760 mmHg |
| Indeks bias |
1.555 |
| Titik nyala |
140.1°C |
| Tekanan wap |
0.000429mmHg at 25°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
