ChemNet > CAS > 6738-23-4 2,4-Dimethylanisole
6738-23-4 2,4-Dimethylanisole
| Nama produk |
2,4-Dimethylanisole |
| Nama Inggeris |
2,4-Dimethylanisole; 1,3-Dimethyl-4-methoxybenzene; 4-Methoxy-m-xylene |
| MF |
C9H12O |
| Berat Molekul |
136.19 |
| InChI |
InChI=1/C9H12O/c1-7-4-5-9(10-3)8(2)6-7/h4-6H,1-3H3 |
| CAS NO |
6738-23-4 |
| EINECS |
229-794-9 |
| Struktur Molekul |
|
| Kepadatan |
0.97 |
| Titik didih |
191℃ |
| Indeks bias |
1.513-1.515 |
| Titik nyala |
63℃ |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
