ChemNet > CAS > 6848-13-1 3-Chloro-N,N-dimethylaniline
6848-13-1 3-Chloro-N,N-dimethylaniline
| Nama produk |
3-Chloro-N,N-dimethylaniline |
| Nama Inggeris |
3-Chloro-N,N-dimethylaniline; 3-Chloro-NN-dimethylaniline |
| MF |
C8H10ClN |
| Berat Molekul |
155.6247 |
| InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| CAS NO |
6848-13-1 |
| EINECS |
229-935-4 |
| Struktur Molekul |
|
| Kepadatan |
1.117g/cm3 |
| Titik didih |
232.663°C at 760 mmHg |
| Indeks bias |
1.566 |
| Titik nyala |
94.512°C |
| Tekanan wap |
0.058mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
