ChemNet > CAS > 68983-70-0 1-(4-methylphenyl)-1-cyclopentanecarbonitrile
68983-70-0 1-(4-methylphenyl)-1-cyclopentanecarbonitrile
| Nama produk |
1-(4-methylphenyl)-1-cyclopentanecarbonitrile |
| Sinonim |
; 1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
| Nama Inggeris |
1-(4-Methylphenyl)-1-cyclopentanecarbonitrile; 1-(p-Tolyl)-1-cyclopentanecarbonitrile; 1-(4-methylphenyl)cyclopentanecarbonitrile |
| MF |
C13H15N |
| Berat Molekul |
185.2649 |
| InChI |
InChI=1/C13H15N/c1-11-4-6-12(7-5-11)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| CAS NO |
68983-70-0 |
| EINECS |
273-487-2 |
| Struktur Molekul |
|
| Kepadatan |
1.02g/cm3 |
| Titik didih |
326.2°C at 760 mmHg |
| Indeks bias |
1.546 |
| Titik nyala |
121.3°C |
| Tekanan wap |
0.000219mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|