6937-34-4 3-iodophthalic acid
Nama produk |
3-iodophthalic acid |
Nama Inggeris |
3-iodophthalic acid; 3-iodobenzene-1,2-dicarboxylic acid; 3-Iodophthaltc acid |
MF |
C8H5IO4 |
Berat Molekul |
292.0274 |
InChI |
InChI=1/C8H5IO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
CAS NO |
6937-34-4 |
Struktur Molekul |
|
Kepadatan |
2.138g/cm3 |
Titik lebur |
232℃ |
Titik didih |
426.3°C at 760 mmHg |
Indeks bias |
1.704 |
Titik nyala |
211.6°C |
Tekanan wap |
5.01E-08mmHg at 25°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|