ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
Nama produk |
2,4-Dichloro-6-iodoaniline |
Nama Inggeris |
2,4-Dichloro-6-iodoaniline; |
MF |
C6H4Cl2IN |
Berat Molekul |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS NO |
697-90-5 |
Struktur Molekul |
|
Kepadatan |
2.091g/cm3 |
Titik didih |
303.8°C at 760 mmHg |
Indeks bias |
1.699 |
Titik nyala |
137.5°C |
Tekanan wap |
0.000911mmHg at 25°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|